![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Affidavit OL.pdf | 2024-06-07 13:58 | 1.7M | |
| Expected Learners.pdf | 2024-06-07 10:32 | 511K | |
| Fee Structure.pdf | 2024-06-07 10:32 | 458K | |
| Programme ODL cum OL..> | 2024-06-07 10:32 | 457K | |
| Requirement of Facul..> | 2024-06-07 10:32 | 398K | |
| Certification for In..> | 2024-06-07 10:32 | 320K | |
| Parameter Consistenc..> | 2024-06-07 10:32 | 304K | |
| Weightage to End sem..> | 2024-06-07 10:32 | 291K | |
| Certification of ade..> | 2024-06-07 10:32 | 288K | |
| Territorial Jurisdic..> | 2024-06-07 10:32 | 278K | |
| Security measures fo..> | 2024-06-07 10:32 | 259K | |
| MOU Swayam 2.pdf | 2024-06-07 10:32 | 259K | |
| No Franchisee Agreee..> | 2024-06-07 10:32 | 257K | |
| Certification for re..> | 2024-06-07 10:32 | 250K | |
| In House SLM Online.pdf | 2024-06-07 10:32 | 247K | |
| Undertaking Cum Decl..> | 2024-06-07 13:58 | 172K | |